C19H24BN5O4 — CID 164542719
5-[(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)amino]-1H-pyrazole-4-carboxamide;oxane-4-carbonitrile (PubChem CID 164542719) has the molecular formula C19H24BN5O4 and a molecular weight of 397.24 g/mol. Its IUPAC name is 5-[(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)amino]-1H-pyrazole-4-carboxamide;oxane-4-carbonitrile.
| Compound Name | 5-[(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)amino]-1H-pyrazole-4-carboxamide;oxane-4-carbonitrile |
|---|---|
| PubChem CID | 164542719 |
| Molecular Formula | C19H24BN5O4 |
| Molecular Weight | 397.24 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 5-[(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)amino]-1H-pyrazole-4-carboxamide;oxane-4-carbonitrile |
| SMILES | CC1(C)OB(O)c2cc(Nc3[nH]ncc3C(N)=O)ccc21.N#CC1CCOCC1 |
| InChI | InChI=1S/C13H15BN4O3.C6H9NO/c1-13(2)9-4-3-7(5-10(9)14(20)21-13)17-12-8(11(15)19)6-16-18-12;7-5-6-1-3-8-4-2-6/h3-6,20H,1-2H3,(H2,15,19)(H2,16,17,18);6H,1-4H2 |
| InChIKey | LQQGLXBMVPGUKR-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 146.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.24 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|