C16H14BClN2O5 — CID 70792656
2-chloro-N-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)-5-nitrobenzamide (PubChem CID 70792656) has the molecular formula C16H14BClN2O5 and a molecular weight of 360.56 g/mol. Its IUPAC name is 2-chloro-N-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)-5-nitrobenzamide.
| Compound Name | 2-chloro-N-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)-5-nitrobenzamide |
|---|---|
| PubChem CID | 70792656 |
| Molecular Formula | C16H14BClN2O5 |
| Molecular Weight | 360.56 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 2-chloro-N-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-6-yl)-5-nitrobenzamide |
| SMILES | CC1(C)OB(O)c2cc(NC(=O)c3cc([N+](=O)[O-])ccc3Cl)ccc21 |
| InChI | InChI=1S/C16H14BClN2O5/c1-16(2)12-5-3-9(7-13(12)17(22)25-16)19-15(21)11-8-10(20(23)24)4-6-14(11)18/h3-8,22H,1-2H3,(H,19,21) |
| InChIKey | QDMHSVYTAYYGJK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.56 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|