C21H26BN5O4 — CID 174013158
3-[(2-hydroxy-4,8-dimethyl-1,2-benzoxaborinin-6-yl)amino]-1-[(3R,4S)-4-(methyliminomethyl)oxan-3-yl]pyrazole-4-carboxamide (PubChem CID 174013158) has the molecular formula C21H26BN5O4 and a molecular weight of 423.28 g/mol. Its IUPAC name is 3-[(2-hydroxy-4,8-dimethyl-1,2-benzoxaborinin-6-yl)amino]-1-[(3R,4S)-4-(methyliminomethyl)oxan-3-yl]pyrazole-4-carboxamide.
| Compound Name | 3-[(2-hydroxy-4,8-dimethyl-1,2-benzoxaborinin-6-yl)amino]-1-[(3R,4S)-4-(methyliminomethyl)oxan-3-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 174013158 |
| Molecular Formula | C21H26BN5O4 |
| Molecular Weight | 423.28 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | 3-[(2-hydroxy-4,8-dimethyl-1,2-benzoxaborinin-6-yl)amino]-1-[(3R,4S)-4-(methyliminomethyl)oxan-3-yl]pyrazole-4-carboxamide |
| SMILES | C/N=C/[C@H]1CCOC[C@@H]1n1cc(C(N)=O)c(Nc2cc(C)c3c(c2)C(C)=CB(O)O3)n1 |
| InChI | InChI=1S/C21H26BN5O4/c1-12-6-15(7-16-13(2)8-22(29)31-19(12)16)25-21-17(20(23)28)10-27(26-21)18-11-30-5-4-14(18)9-24-3/h6-10,14,18,29H,4-5,11H2,1-3H3,(H2,23,28)(H,25,26)/b24-9+/t14-,18+/m1/s1 |
| InChIKey | KYCWHVOUFDULAG-JUNQORKYSA-N |
| XLogP | 2.13 |
| TPSA | 123.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.28 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|