C25H35N5O4Si — CID 174013078
3-[3-ethynyl-4-(2-trimethylsilylethoxymethoxy)anilino]-1-[(3R)-4-(methyliminomethyl)oxan-3-yl]pyrazole-4-carboxamide (PubChem CID 174013078) has the molecular formula C25H35N5O4Si and a molecular weight of 497.67 g/mol. Its IUPAC name is 3-[3-ethynyl-4-(2-trimethylsilylethoxymethoxy)anilino]-1-[(3R)-4-(methyliminomethyl)oxan-3-yl]pyrazole-4-carboxamide.
| Compound Name | 3-[3-ethynyl-4-(2-trimethylsilylethoxymethoxy)anilino]-1-[(3R)-4-(methyliminomethyl)oxan-3-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 174013078 |
| Molecular Formula | C25H35N5O4Si |
| Molecular Weight | 497.67 g/mol |
| Exact Mass | 497.25 |
| IUPAC Name | 3-[3-ethynyl-4-(2-trimethylsilylethoxymethoxy)anilino]-1-[(3R)-4-(methyliminomethyl)oxan-3-yl]pyrazole-4-carboxamide |
| SMILES | C#Cc1cc(Nc2nn([C@H]3COCCC3/C=N\C)cc2C(N)=O)ccc1OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C25H35N5O4Si/c1-6-18-13-20(7-8-23(18)34-17-33-11-12-35(3,4)5)28-25-21(24(26)31)15-30(29-25)22-16-32-10-9-19(22)14-27-2/h1,7-8,13-15,19,22H,9-12,16-17H2,2-5H3,(H2,26,31)(H,28,29)/b27-14-/t19?,22-/m0/s1 |
| InChIKey | VAKPKTPSDIFNHO-YQUMZTPESA-N |
| XLogP | 3.68 |
| TPSA | 112.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.67 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|