C17H20FN5O3 — CID 167472814
1-[(3R,4R)-4-ethenyloxan-3-yl]-3-[(2-fluoro-6-methoxy-4-pyridinyl)amino]pyrazole-4-carboxamide (PubChem CID 167472814) has the molecular formula C17H20FN5O3 and a molecular weight of 361.38 g/mol. Its IUPAC name is 1-[(3R,4R)-4-ethenyloxan-3-yl]-3-[(2-fluoro-6-methoxy-4-pyridinyl)amino]pyrazole-4-carboxamide.
| Compound Name | 1-[(3R,4R)-4-ethenyloxan-3-yl]-3-[(2-fluoro-6-methoxy-4-pyridinyl)amino]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 167472814 |
| Molecular Formula | C17H20FN5O3 |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 1-[(3R,4R)-4-ethenyloxan-3-yl]-3-[(2-fluoro-6-methoxy-4-pyridinyl)amino]pyrazole-4-carboxamide |
| SMILES | C=C[C@H]1CCOC[C@@H]1n1cc(C(N)=O)c(Nc2cc(F)nc(OC)c2)n1 |
| InChI | InChI=1S/C17H20FN5O3/c1-3-10-4-5-26-9-13(10)23-8-12(16(19)24)17(22-23)20-11-6-14(18)21-15(7-11)25-2/h3,6-8,10,13H,1,4-5,9H2,2H3,(H2,19,24)(H,20,21,22)/t10-,13-/m0/s1 |
| InChIKey | FKRRCXMMBFVHQI-GWCFXTLKSA-N |
| XLogP | 2.03 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|