C18H24FN5O4 — CID 154933809
ethyl 3-[(2-fluoro-6-methoxy-4-pyridinyl)amino]-1-[(3R,4S)-4-(methylamino)oxan-3-yl]pyrazole-4-carboxylate (PubChem CID 154933809) has the molecular formula C18H24FN5O4 and a molecular weight of 393.42 g/mol. Its IUPAC name is ethyl 3-[(2-fluoro-6-methoxy-4-pyridinyl)amino]-1-[(3R,4S)-4-(methylamino)oxan-3-yl]pyrazole-4-carboxylate.
| Compound Name | ethyl 3-[(2-fluoro-6-methoxy-4-pyridinyl)amino]-1-[(3R,4S)-4-(methylamino)oxan-3-yl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 154933809 |
| Molecular Formula | C18H24FN5O4 |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | ethyl 3-[(2-fluoro-6-methoxy-4-pyridinyl)amino]-1-[(3R,4S)-4-(methylamino)oxan-3-yl]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn([C@H]2COCC[C@@H]2NC)nc1Nc1cc(F)nc(OC)c1 |
| InChI | InChI=1S/C18H24FN5O4/c1-4-28-18(25)12-9-24(14-10-27-6-5-13(14)20-2)23-17(12)21-11-7-15(19)22-16(8-11)26-3/h7-9,13-14,20H,4-6,10H2,1-3H3,(H,21,22,23)/t13-,14-/m0/s1 |
| InChIKey | KCGSDIPSAUVAHU-KBPBESRZSA-N |
| XLogP | 1.90 |
| TPSA | 99.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|