C17H20FN5O4 — CID 166948707
3-[(2-fluoro-6-methoxy-4-pyridinyl)amino]-1-[(3R,4S)-4-(methyliminomethyl)oxan-3-yl]pyrazole-4-carboxylic acid (PubChem CID 166948707) has the molecular formula C17H20FN5O4 and a molecular weight of 377.38 g/mol. Its IUPAC name is 3-[(2-fluoro-6-methoxy-4-pyridinyl)amino]-1-[(3R,4S)-4-(methyliminomethyl)oxan-3-yl]pyrazole-4-carboxylic acid.
| Compound Name | 3-[(2-fluoro-6-methoxy-4-pyridinyl)amino]-1-[(3R,4S)-4-(methyliminomethyl)oxan-3-yl]pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 166948707 |
| Molecular Formula | C17H20FN5O4 |
| Molecular Weight | 377.38 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 3-[(2-fluoro-6-methoxy-4-pyridinyl)amino]-1-[(3R,4S)-4-(methyliminomethyl)oxan-3-yl]pyrazole-4-carboxylic acid |
| SMILES | C/N=C/[C@H]1CCOC[C@@H]1n1cc(C(=O)O)c(Nc2cc(F)nc(OC)c2)n1 |
| InChI | InChI=1S/C17H20FN5O4/c1-19-7-10-3-4-27-9-13(10)23-8-12(17(24)25)16(22-23)20-11-5-14(18)21-15(6-11)26-2/h5-8,10,13H,3-4,9H2,1-2H3,(H,24,25)(H,20,21,22)/b19-7+/t10-,13+/m1/s1 |
| InChIKey | XRSRWDLDQXBWQE-PFTZBYMESA-N |
| XLogP | 2.15 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.38 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|