C28H43N5O4Si2 — CID 174013751
1-[(4S)-4-(methyliminomethyl)oxan-3-yl]-3-[4-(2-trimethylsilylethoxymethoxy)-3-(2-trimethylsilylethynyl)anilino]pyrazole-4-carboxamide (PubChem CID 174013751) has the molecular formula C28H43N5O4Si2 and a molecular weight of 569.86 g/mol. Its IUPAC name is 1-[(4S)-4-(methyliminomethyl)oxan-3-yl]-3-[4-(2-trimethylsilylethoxymethoxy)-3-(2-trimethylsilylethynyl)anilino]pyrazole-4-carboxamide.
| Compound Name | 1-[(4S)-4-(methyliminomethyl)oxan-3-yl]-3-[4-(2-trimethylsilylethoxymethoxy)-3-(2-trimethylsilylethynyl)anilino]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 174013751 |
| Molecular Formula | C28H43N5O4Si2 |
| Molecular Weight | 569.86 g/mol |
| Exact Mass | 569.29 |
| IUPAC Name | 1-[(4S)-4-(methyliminomethyl)oxan-3-yl]-3-[4-(2-trimethylsilylethoxymethoxy)-3-(2-trimethylsilylethynyl)anilino]pyrazole-4-carboxamide |
| SMILES | C/N=C\[C@H]1CCOCC1n1cc(C(N)=O)c(Nc2ccc(OCOCC[Si](C)(C)C)c(C#C[Si](C)(C)C)c2)n1 |
| InChI | InChI=1S/C28H43N5O4Si2/c1-30-17-22-10-12-35-19-25(22)33-18-24(27(29)34)28(32-33)31-23-8-9-26(21(16-23)11-14-38(2,3)4)37-20-36-13-15-39(5,6)7/h8-9,16-18,22,25H,10,12-13,15,19-20H2,1-7H3,(H2,29,34)(H,31,32)/b30-17-/t22-,25?/m1/s1 |
| InChIKey | ARWXWJSZLFRLAU-SIUPTNMJSA-N |
| XLogP | 4.92 |
| TPSA | 112.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.86 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|