C30H49BN4O5Si — CID 174013065
3-[4-[2-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-3-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)anilino]-1-[(3S,4R)-4-methyloxan-3-yl]pyrazole-4-carboxamide (PubChem CID 174013065) has the molecular formula C30H49BN4O5Si and a molecular weight of 584.64 g/mol. Its IUPAC name is 3-[4-[2-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-3-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)anilino]-1-[(3S,4R)-4-methyloxan-3-yl]pyrazole-4-carboxamide.
| Compound Name | 3-[4-[2-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-3-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)anilino]-1-[(3S,4R)-4-methyloxan-3-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 174013065 |
| Molecular Formula | C30H49BN4O5Si |
| Molecular Weight | 584.64 g/mol |
| Exact Mass | 584.36 |
| IUPAC Name | 3-[4-[2-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-3-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)anilino]-1-[(3S,4R)-4-methyloxan-3-yl]pyrazole-4-carboxamide |
| SMILES | C[C@@H]1CCOC[C@H]1n1cc(C(N)=O)c(Nc2ccc(C(C)(C)O[Si](C)(C)C(C)(C)C)c(B3OCC(C)(C)CO3)c2)n1 |
| InChI | InChI=1S/C30H49BN4O5Si/c1-20-13-14-37-17-25(20)35-16-22(26(32)36)27(34-35)33-21-11-12-23(30(7,8)40-41(9,10)28(2,3)4)24(15-21)31-38-18-29(5,6)19-39-31/h11-12,15-16,20,25H,13-14,17-19H2,1-10H3,(H2,32,36)(H,33,34)/t20-,25-/m1/s1 |
| InChIKey | IOLXQTYXVNBUQL-CJFMBICVSA-N |
| XLogP | 5.35 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.64 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|