C10H13N5O2 — CID 123626639
3-amino-1-[(3R,4S)-4-isocyanooxan-3-yl]pyrazole-4-carboxamide (PubChem CID 123626639) has the molecular formula C10H13N5O2 and a molecular weight of 235.25 g/mol. Its IUPAC name is 3-amino-1-[(3R,4S)-4-isocyanooxan-3-yl]pyrazole-4-carboxamide.
| Compound Name | 3-amino-1-[(3R,4S)-4-isocyanooxan-3-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 123626639 |
| Molecular Formula | C10H13N5O2 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 3-amino-1-[(3R,4S)-4-isocyanooxan-3-yl]pyrazole-4-carboxamide |
| SMILES | [C-]#[N+][C@H]1CCOC[C@@H]1n1cc(C(N)=O)c(N)n1 |
| InChI | InChI=1S/C10H13N5O2/c1-13-7-2-3-17-5-8(7)15-4-6(10(12)16)9(11)14-15/h4,7-8H,2-3,5H2,(H2,11,14)(H2,12,16)/t7-,8-/m0/s1 |
| InChIKey | LIXKJEZZOAUUPQ-YUMQZZPRSA-N |
| XLogP | -0.19 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|