C10H12N4O3 — CID 155254944
3-amino-1-[(3S,4R)-4-cyanooxan-3-yl]pyrazole-4-carboxylic acid (PubChem CID 155254944) has the molecular formula C10H12N4O3 and a molecular weight of 236.23 g/mol. Its IUPAC name is 3-amino-1-[(3S,4R)-4-cyanooxan-3-yl]pyrazole-4-carboxylic acid.
| Compound Name | 3-amino-1-[(3S,4R)-4-cyanooxan-3-yl]pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 155254944 |
| Molecular Formula | C10H12N4O3 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 3-amino-1-[(3S,4R)-4-cyanooxan-3-yl]pyrazole-4-carboxylic acid |
| SMILES | N#C[C@@H]1CCOC[C@H]1n1cc(C(=O)O)c(N)n1 |
| InChI | InChI=1S/C10H12N4O3/c11-3-6-1-2-17-5-8(6)14-4-7(10(15)16)9(12)13-14/h4,6,8H,1-2,5H2,(H2,12,13)(H,15,16)/t6-,8+/m0/s1 |
| InChIKey | QYSOTHSOAVEZAX-POYBYMJQSA-N |
| XLogP | 0.26 |
| TPSA | 114.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |