C15H24N4O — CID 130284394
3-amino-1-[(8R,9R)-9-methylspiro[4.5]decan-8-yl]pyrazole-4-carboxamide (PubChem CID 130284394) has the molecular formula C15H24N4O and a molecular weight of 276.38 g/mol. Its IUPAC name is 3-amino-1-[(8R,9R)-9-methylspiro[4.5]decan-8-yl]pyrazole-4-carboxamide.
| Compound Name | 3-amino-1-[(8R,9R)-9-methylspiro[4.5]decan-8-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 130284394 |
| Molecular Formula | C15H24N4O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 3-amino-1-[(8R,9R)-9-methylspiro[4.5]decan-8-yl]pyrazole-4-carboxamide |
| SMILES | C[C@@H]1CC2(CCCC2)CC[C@H]1n1cc(C(N)=O)c(N)n1 |
| InChI | InChI=1S/C15H24N4O/c1-10-8-15(5-2-3-6-15)7-4-12(10)19-9-11(14(17)20)13(16)18-19/h9-10,12H,2-8H2,1H3,(H2,16,18)(H2,17,20)/t10-,12-/m1/s1 |
| InChIKey | PGQIJMMIVPENJU-ZYHUDNBSSA-N |
| XLogP | 2.49 |
| TPSA | 86.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |