C17H22N4O2 — CID 152964021
3-anilino-1-[(1S,2R,3S)-3-hydroxy-2-methylcyclohexyl]pyrazole-4-carboxamide (PubChem CID 152964021) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 3-anilino-1-[(1S,2R,3S)-3-hydroxy-2-methylcyclohexyl]pyrazole-4-carboxamide.
| Compound Name | 3-anilino-1-[(1S,2R,3S)-3-hydroxy-2-methylcyclohexyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 152964021 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 3-anilino-1-[(1S,2R,3S)-3-hydroxy-2-methylcyclohexyl]pyrazole-4-carboxamide |
| SMILES | C[C@H]1[C@@H](O)CCC[C@@H]1n1cc(C(N)=O)c(Nc2ccccc2)n1 |
| InChI | InChI=1S/C17H22N4O2/c1-11-14(8-5-9-15(11)22)21-10-13(16(18)23)17(20-21)19-12-6-3-2-4-7-12/h2-4,6-7,10-11,14-15,22H,5,8-9H2,1H3,(H2,18,23)(H,19,20)/t11-,14+,15+/m1/s1 |
| InChIKey | URDQISKVNUMWLQ-UGFHNGPFSA-N |
| XLogP | 2.45 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |