C21H26N6O — CID 89464126
3-anilino-1-[2-cyano-4-[(1-methylcyclopropyl)amino]cyclohexyl]pyrazole-4-carboxamide (PubChem CID 89464126) has the molecular formula C21H26N6O and a molecular weight of 378.48 g/mol. Its IUPAC name is 3-anilino-1-[2-cyano-4-[(1-methylcyclopropyl)amino]cyclohexyl]pyrazole-4-carboxamide.
| Compound Name | 3-anilino-1-[2-cyano-4-[(1-methylcyclopropyl)amino]cyclohexyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 89464126 |
| Molecular Formula | C21H26N6O |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 3-anilino-1-[2-cyano-4-[(1-methylcyclopropyl)amino]cyclohexyl]pyrazole-4-carboxamide |
| SMILES | CC1(NC2CCC(n3cc(C(N)=O)c(Nc4ccccc4)n3)C(C#N)C2)CC1 |
| InChI | InChI=1S/C21H26N6O/c1-21(9-10-21)25-16-7-8-18(14(11-16)12-22)27-13-17(19(23)28)20(26-27)24-15-5-3-2-4-6-15/h2-6,13-14,16,18,25H,7-11H2,1H3,(H2,23,28)(H,24,26) |
| InChIKey | VROUQYLMZYYKSO-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 108.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |