C17H19N5O2 — CID 90369491
3-anilino-1-[(1R,6R)-2-cyano-6-hydroxycyclohexyl]pyrazole-4-carboxamide (PubChem CID 90369491) has the molecular formula C17H19N5O2 and a molecular weight of 325.37 g/mol. Its IUPAC name is 3-anilino-1-[(1R,6R)-2-cyano-6-hydroxycyclohexyl]pyrazole-4-carboxamide.
| Compound Name | 3-anilino-1-[(1R,6R)-2-cyano-6-hydroxycyclohexyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 90369491 |
| Molecular Formula | C17H19N5O2 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 3-anilino-1-[(1R,6R)-2-cyano-6-hydroxycyclohexyl]pyrazole-4-carboxamide |
| SMILES | N#CC1CCC[C@@H](O)[C@@H]1n1cc(C(N)=O)c(Nc2ccccc2)n1 |
| InChI | InChI=1S/C17H19N5O2/c18-9-11-5-4-8-14(23)15(11)22-10-13(16(19)24)17(21-22)20-12-6-2-1-3-7-12/h1-3,6-7,10-11,14-15,23H,4-5,8H2,(H2,19,24)(H,20,21)/t11?,14-,15-/m1/s1 |
| InChIKey | GVFQMFLSGMSFPE-PJYWTSEFSA-N |
| XLogP | 1.95 |
| TPSA | 116.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |