C10H12N4O2 — CID 164800737
1-[(3S,4R)-4-cyanooxan-3-yl]pyrazole-4-carboxamide (PubChem CID 164800737) has the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. Its IUPAC name is 1-[(3S,4R)-4-cyanooxan-3-yl]pyrazole-4-carboxamide.
| Compound Name | 1-[(3S,4R)-4-cyanooxan-3-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 164800737 |
| Molecular Formula | C10H12N4O2 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 1-[(3S,4R)-4-cyanooxan-3-yl]pyrazole-4-carboxamide |
| SMILES | N#C[C@@H]1CCOC[C@H]1n1cc(C(N)=O)cn1 |
| InChI | InChI=1S/C10H12N4O2/c11-3-7-1-2-16-6-9(7)14-5-8(4-13-14)10(12)15/h4-5,7,9H,1-2,6H2,(H2,12,15)/t7-,9+/m0/s1 |
| InChIKey | YJDXWURNXKOLTJ-IONNQARKSA-N |
| XLogP | 0.08 |
| TPSA | 93.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |