C24H23FN8O — CID 89462510
1-[4-(cyanomethyl)-1-[(3-cyanophenyl)methyl]piperidin-4-yl]-3-[(2-fluoro-4-pyridinyl)amino]pyrazole-4-carboxamide (PubChem CID 89462510) has the molecular formula C24H23FN8O and a molecular weight of 458.50 g/mol. Its IUPAC name is 1-[4-(cyanomethyl)-1-[(3-cyanophenyl)methyl]piperidin-4-yl]-3-[(2-fluoro-4-pyridinyl)amino]pyrazole-4-carboxamide.
| Compound Name | 1-[4-(cyanomethyl)-1-[(3-cyanophenyl)methyl]piperidin-4-yl]-3-[(2-fluoro-4-pyridinyl)amino]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 89462510 |
| Molecular Formula | C24H23FN8O |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 1-[4-(cyanomethyl)-1-[(3-cyanophenyl)methyl]piperidin-4-yl]-3-[(2-fluoro-4-pyridinyl)amino]pyrazole-4-carboxamide |
| SMILES | N#CCC1(n2cc(C(N)=O)c(Nc3ccnc(F)c3)n2)CCN(Cc2cccc(C#N)c2)CC1 |
| InChI | InChI=1S/C24H23FN8O/c25-21-13-19(4-9-29-21)30-23-20(22(28)34)16-33(31-23)24(5-8-26)6-10-32(11-7-24)15-18-3-1-2-17(12-18)14-27/h1-4,9,12-13,16H,5-7,10-11,15H2,(H2,28,34)(H,29,30,31) |
| InChIKey | SPRGONMPHRAGEI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 136.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|