C20H29FN6O2 — CID 123533417
1-[1-(aminomethyl)-4-(2-methoxyethylamino)cyclohexyl]-3-(4-fluoroanilino)pyrazole-4-carboxamide (PubChem CID 123533417) has the molecular formula C20H29FN6O2 and a molecular weight of 404.49 g/mol. Its IUPAC name is 1-[1-(aminomethyl)-4-(2-methoxyethylamino)cyclohexyl]-3-(4-fluoroanilino)pyrazole-4-carboxamide.
| Compound Name | 1-[1-(aminomethyl)-4-(2-methoxyethylamino)cyclohexyl]-3-(4-fluoroanilino)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 123533417 |
| Molecular Formula | C20H29FN6O2 |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | 1-[1-(aminomethyl)-4-(2-methoxyethylamino)cyclohexyl]-3-(4-fluoroanilino)pyrazole-4-carboxamide |
| SMILES | COCCNC1CCC(CN)(n2cc(C(N)=O)c(Nc3ccc(F)cc3)n2)CC1 |
| InChI | InChI=1S/C20H29FN6O2/c1-29-11-10-24-15-6-8-20(13-22,9-7-15)27-12-17(18(23)28)19(26-27)25-16-4-2-14(21)3-5-16/h2-5,12,15,24H,6-11,13,22H2,1H3,(H2,23,28)(H,25,26) |
| InChIKey | BTTMPHAGIIMOKM-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 120.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|