C21H25FN6O4 — CID 90348908
3-methoxypropyl (3R,4S)-4-[4-carbamoyl-3-(4-fluoroanilino)pyrazol-1-yl]-3-cyanopiperidine-1-carboxylate (PubChem CID 90348908) has the molecular formula C21H25FN6O4 and a molecular weight of 444.47 g/mol. Its IUPAC name is 3-methoxypropyl (3R,4S)-4-[4-carbamoyl-3-(4-fluoroanilino)pyrazol-1-yl]-3-cyanopiperidine-1-carboxylate.
| Compound Name | 3-methoxypropyl (3R,4S)-4-[4-carbamoyl-3-(4-fluoroanilino)pyrazol-1-yl]-3-cyanopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 90348908 |
| Molecular Formula | C21H25FN6O4 |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 3-methoxypropyl (3R,4S)-4-[4-carbamoyl-3-(4-fluoroanilino)pyrazol-1-yl]-3-cyanopiperidine-1-carboxylate |
| SMILES | COCCCOC(=O)N1CC[C@H](n2cc(C(N)=O)c(Nc3ccc(F)cc3)n2)[C@H](C#N)C1 |
| InChI | InChI=1S/C21H25FN6O4/c1-31-9-2-10-32-21(30)27-8-7-18(14(11-23)12-27)28-13-17(19(24)29)20(26-28)25-16-5-3-15(22)4-6-16/h3-6,13-14,18H,2,7-10,12H2,1H3,(H2,24,29)(H,25,26)/t14-,18+/m1/s1 |
| InChIKey | UHZKGARVKDTXJF-KDOFPFPSSA-N |
| XLogP | 2.42 |
| TPSA | 135.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|