C22H25FN6O4 — CID 71537859
oxan-4-yl 4-[4-carbamoyl-3-(4-fluoroanilino)pyrazol-1-yl]-3-cyanopiperidine-1-carboxylate (PubChem CID 71537859) has the molecular formula C22H25FN6O4 and a molecular weight of 456.48 g/mol. Its IUPAC name is oxan-4-yl 4-[4-carbamoyl-3-(4-fluoroanilino)pyrazol-1-yl]-3-cyanopiperidine-1-carboxylate.
| Compound Name | oxan-4-yl 4-[4-carbamoyl-3-(4-fluoroanilino)pyrazol-1-yl]-3-cyanopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 71537859 |
| Molecular Formula | C22H25FN6O4 |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | oxan-4-yl 4-[4-carbamoyl-3-(4-fluoroanilino)pyrazol-1-yl]-3-cyanopiperidine-1-carboxylate |
| SMILES | N#CC1CN(C(=O)OC2CCOCC2)CCC1n1cc(C(N)=O)c(Nc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C22H25FN6O4/c23-15-1-3-16(4-2-15)26-21-18(20(25)30)13-29(27-21)19-5-8-28(12-14(19)11-24)22(31)33-17-6-9-32-10-7-17/h1-4,13-14,17,19H,5-10,12H2,(H2,25,30)(H,26,27) |
| InChIKey | ICTMHLMSIULYBP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 135.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |