C21H25FN6O4 — CID 129199365
oxan-4-yl (3R)-3-[4-carbamoyl-3-(4-fluoroanilino)pyrazol-1-yl]-4-iminopiperidine-1-carboxylate (PubChem CID 129199365) has the molecular formula C21H25FN6O4 and a molecular weight of 444.47 g/mol. Its IUPAC name is oxan-4-yl (3R)-3-[4-carbamoyl-3-(4-fluoroanilino)pyrazol-1-yl]-4-iminopiperidine-1-carboxylate.
| Compound Name | oxan-4-yl (3R)-3-[4-carbamoyl-3-(4-fluoroanilino)pyrazol-1-yl]-4-iminopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 129199365 |
| Molecular Formula | C21H25FN6O4 |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | oxan-4-yl (3R)-3-[4-carbamoyl-3-(4-fluoroanilino)pyrazol-1-yl]-4-iminopiperidine-1-carboxylate |
| SMILES | [H]/N=C1\CCN(C(=O)OC2CCOCC2)C[C@H]1n1cc(C(N)=O)c(Nc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C21H25FN6O4/c22-13-1-3-14(4-2-13)25-20-16(19(24)29)11-28(26-20)18-12-27(8-5-17(18)23)21(30)32-15-6-9-31-10-7-15/h1-4,11,15,18,23H,5-10,12H2,(H2,24,29)(H,25,26)/b23-17+/t18-/m1/s1 |
| InChIKey | FKMBAABOPGDEQR-KIJZHVTOSA-N |
| XLogP | 2.45 |
| TPSA | 135.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|