C20H21F4N5O3 — CID 129199272
2,2,2-trifluoroethyl (3S,4S)-3-[4-carbamoyl-3-(4-fluoroanilino)pyrazol-1-yl]-4-ethenylpiperidine-1-carboxylate (PubChem CID 129199272) has the molecular formula C20H21F4N5O3 and a molecular weight of 455.41 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl (3S,4S)-3-[4-carbamoyl-3-(4-fluoroanilino)pyrazol-1-yl]-4-ethenylpiperidine-1-carboxylate.
| Compound Name | 2,2,2-trifluoroethyl (3S,4S)-3-[4-carbamoyl-3-(4-fluoroanilino)pyrazol-1-yl]-4-ethenylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 129199272 |
| Molecular Formula | C20H21F4N5O3 |
| Molecular Weight | 455.41 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | 2,2,2-trifluoroethyl (3S,4S)-3-[4-carbamoyl-3-(4-fluoroanilino)pyrazol-1-yl]-4-ethenylpiperidine-1-carboxylate |
| SMILES | C=C[C@@H]1CCN(C(=O)OCC(F)(F)F)C[C@H]1n1cc(C(N)=O)c(Nc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C20H21F4N5O3/c1-2-12-7-8-28(19(31)32-11-20(22,23)24)10-16(12)29-9-15(17(25)30)18(27-29)26-14-5-3-13(21)4-6-14/h2-6,9,12,16H,1,7-8,10-11H2,(H2,25,30)(H,26,27)/t12-,16-/m1/s1 |
| InChIKey | ITOITBRSVAGGHS-MLGOLLRUSA-N |
| XLogP | 3.61 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|