C20H23F2N5O3 — CID 89470861
2-fluoroethyl (3S,4S)-3-[4-carbamoyl-3-(4-fluoroanilino)pyrazol-1-yl]-4-ethenylpiperidine-1-carboxylate (PubChem CID 89470861) has the molecular formula C20H23F2N5O3 and a molecular weight of 419.43 g/mol. Its IUPAC name is 2-fluoroethyl (3S,4S)-3-[4-carbamoyl-3-(4-fluoroanilino)pyrazol-1-yl]-4-ethenylpiperidine-1-carboxylate.
| Compound Name | 2-fluoroethyl (3S,4S)-3-[4-carbamoyl-3-(4-fluoroanilino)pyrazol-1-yl]-4-ethenylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 89470861 |
| Molecular Formula | C20H23F2N5O3 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 2-fluoroethyl (3S,4S)-3-[4-carbamoyl-3-(4-fluoroanilino)pyrazol-1-yl]-4-ethenylpiperidine-1-carboxylate |
| SMILES | C=C[C@@H]1CCN(C(=O)OCCF)C[C@H]1n1cc(C(N)=O)c(Nc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C20H23F2N5O3/c1-2-13-7-9-26(20(29)30-10-8-21)12-17(13)27-11-16(18(23)28)19(25-27)24-15-5-3-14(22)4-6-15/h2-6,11,13,17H,1,7-10,12H2,(H2,23,28)(H,24,25)/t13-,17-/m1/s1 |
| InChIKey | GZONCGJBVMNMIV-CXAGYDPISA-N |
| XLogP | 3.02 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|