C21H24FN5O4 — CID 129199296
2-methoxyethyl (3S)-3-[4-carbamoyl-3-(4-fluoroanilino)pyrazol-1-yl]-4-ethynylpiperidine-1-carboxylate (PubChem CID 129199296) has the molecular formula C21H24FN5O4 and a molecular weight of 429.45 g/mol. Its IUPAC name is 2-methoxyethyl (3S)-3-[4-carbamoyl-3-(4-fluoroanilino)pyrazol-1-yl]-4-ethynylpiperidine-1-carboxylate.
| Compound Name | 2-methoxyethyl (3S)-3-[4-carbamoyl-3-(4-fluoroanilino)pyrazol-1-yl]-4-ethynylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 129199296 |
| Molecular Formula | C21H24FN5O4 |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | 2-methoxyethyl (3S)-3-[4-carbamoyl-3-(4-fluoroanilino)pyrazol-1-yl]-4-ethynylpiperidine-1-carboxylate |
| SMILES | C#CC1CCN(C(=O)OCCOC)C[C@H]1n1cc(C(N)=O)c(Nc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C21H24FN5O4/c1-3-14-8-9-26(21(29)31-11-10-30-2)13-18(14)27-12-17(19(23)28)20(25-27)24-16-6-4-15(22)5-7-16/h1,4-7,12,14,18H,8-11,13H2,2H3,(H2,23,28)(H,24,25)/t14?,18-/m1/s1 |
| InChIKey | HFXZQOKJTCASEH-XPKAQORNSA-N |
| XLogP | 2.14 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|