C15H21N3O5 — CID 130246101
tert-butyl 2-methoxy-3-nitro-5,6,8,9-tetrahydropyrido[2,3-d]azepine-7-carboxylate (PubChem CID 130246101) has the molecular formula C15H21N3O5 and a molecular weight of 323.35 g/mol. Its IUPAC name is tert-butyl 2-methoxy-3-nitro-5,6,8,9-tetrahydropyrido[2,3-d]azepine-7-carboxylate.
| Compound Name | tert-butyl 2-methoxy-3-nitro-5,6,8,9-tetrahydropyrido[2,3-d]azepine-7-carboxylate |
|---|---|
| PubChem CID | 130246101 |
| Molecular Formula | C15H21N3O5 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | tert-butyl 2-methoxy-3-nitro-5,6,8,9-tetrahydropyrido[2,3-d]azepine-7-carboxylate |
| SMILES | COc1nc2c(cc1[N+](=O)[O-])CCN(C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C15H21N3O5/c1-15(2,3)23-14(19)17-7-5-10-9-12(18(20)21)13(22-4)16-11(10)6-8-17/h9H,5-8H2,1-4H3 |
| InChIKey | UKZHUYYXHCBWGU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 94.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|