C12H20N2O6 — CID 11129950
tert-butyl N-[(6S,7R,8R,8aS)-7,8-dihydroxy-3-oxo-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-6-yl]carbamate (PubChem CID 11129950) has the molecular formula C12H20N2O6 and a molecular weight of 288.30 g/mol. Its IUPAC name is tert-butyl N-[(6S,7R,8R,8aS)-7,8-dihydroxy-3-oxo-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-6-yl]carbamate.
| Compound Name | tert-butyl N-[(6S,7R,8R,8aS)-7,8-dihydroxy-3-oxo-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-6-yl]carbamate |
|---|---|
| PubChem CID | 11129950 |
| Molecular Formula | C12H20N2O6 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | tert-butyl N-[(6S,7R,8R,8aS)-7,8-dihydroxy-3-oxo-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-6-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CN2C(=O)OC[C@H]2[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H20N2O6/c1-12(2,3)20-10(17)13-6-4-14-7(5-19-11(14)18)9(16)8(6)15/h6-9,15-16H,4-5H2,1-3H3,(H,13,17)/t6-,7-,8+,9+/m0/s1 |
| InChIKey | GLRIXBYWTAZKIR-RBXMUDONSA-N |
| XLogP | -0.56 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |