C13H24N2O5S — CID 97071959
tert-butyl N-[(3S,4S)-4-morpholin-4-yl-1,1-dioxothiolan-3-yl]carbamate (PubChem CID 97071959) has the molecular formula C13H24N2O5S and a molecular weight of 320.41 g/mol. Its IUPAC name is tert-butyl N-[(3S,4S)-4-morpholin-4-yl-1,1-dioxothiolan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,4S)-4-morpholin-4-yl-1,1-dioxothiolan-3-yl]carbamate |
|---|---|
| PubChem CID | 97071959 |
| Molecular Formula | C13H24N2O5S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | tert-butyl N-[(3S,4S)-4-morpholin-4-yl-1,1-dioxothiolan-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CS(=O)(=O)C[C@H]1N1CCOCC1 |
| InChI | InChI=1S/C13H24N2O5S/c1-13(2,3)20-12(16)14-10-8-21(17,18)9-11(10)15-4-6-19-7-5-15/h10-11H,4-9H2,1-3H3,(H,14,16)/t10-,11-/m1/s1 |
| InChIKey | XUAROYMBWWDSCZ-GHMZBOCLSA-N |
| XLogP | 0.01 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |