C10H18N2O3S — CID 24894287
tert-butyl N-(morpholine-4-carbothioyl)carbamate (PubChem CID 24894287) has the molecular formula C10H18N2O3S and a molecular weight of 246.33 g/mol. Its IUPAC name is tert-butyl N-(morpholine-4-carbothioyl)carbamate.
| Compound Name | tert-butyl N-(morpholine-4-carbothioyl)carbamate |
|---|---|
| PubChem CID | 24894287 |
| Molecular Formula | C10H18N2O3S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | tert-butyl N-(morpholine-4-carbothioyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC(=S)N1CCOCC1 |
| InChI | InChI=1S/C10H18N2O3S/c1-10(2,3)15-9(13)11-8(16)12-4-6-14-7-5-12/h4-7H2,1-3H3,(H,11,13,16) |
| InChIKey | GRVBGFNTTAEBHY-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|