C13H25N3O5 — CID 59641605
tert-butyl N-(3-amino-4-morpholin-4-yl-4-oxobutoxy)carbamate (PubChem CID 59641605) has the molecular formula C13H25N3O5 and a molecular weight of 303.36 g/mol. Its IUPAC name is tert-butyl N-(3-amino-4-morpholin-4-yl-4-oxobutoxy)carbamate.
| Compound Name | tert-butyl N-(3-amino-4-morpholin-4-yl-4-oxobutoxy)carbamate |
|---|---|
| PubChem CID | 59641605 |
| Molecular Formula | C13H25N3O5 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | tert-butyl N-(3-amino-4-morpholin-4-yl-4-oxobutoxy)carbamate |
| SMILES | CC(C)(C)OC(=O)NOCCC(N)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C13H25N3O5/c1-13(2,3)21-12(18)15-20-7-4-10(14)11(17)16-5-8-19-9-6-16/h10H,4-9,14H2,1-3H3,(H,15,18) |
| InChIKey | RXSIGXXBDMTVPF-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|