C12H22N2O2S — CID 91827763
tert-butyl N-(4-methylpiperidine-1-carbothioyl)carbamate (PubChem CID 91827763) has the molecular formula C12H22N2O2S and a molecular weight of 258.39 g/mol. Its IUPAC name is tert-butyl N-(4-methylpiperidine-1-carbothioyl)carbamate.
| Compound Name | tert-butyl N-(4-methylpiperidine-1-carbothioyl)carbamate |
|---|---|
| PubChem CID | 91827763 |
| Molecular Formula | C12H22N2O2S |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | tert-butyl N-(4-methylpiperidine-1-carbothioyl)carbamate |
| SMILES | CC1CCN(C(=S)NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C12H22N2O2S/c1-9-5-7-14(8-6-9)10(17)13-11(15)16-12(2,3)4/h9H,5-8H2,1-4H3,(H,13,15,17) |
| InChIKey | JYPUPEXSYQLDSV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|