C17H28N4O4S2 — CID 27236176
2,2-diethyl-N,N'-bis(morpholine-4-carbothioyl)propanediamide (PubChem CID 27236176) has the molecular formula C17H28N4O4S2 and a molecular weight of 416.57 g/mol. Its IUPAC name is 2,2-diethyl-N,N'-bis(morpholine-4-carbothioyl)propanediamide.
| Compound Name | 2,2-diethyl-N,N'-bis(morpholine-4-carbothioyl)propanediamide |
|---|---|
| PubChem CID | 27236176 |
| Molecular Formula | C17H28N4O4S2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 2,2-diethyl-N,N'-bis(morpholine-4-carbothioyl)propanediamide |
| SMILES | CCC(CC)(C(=O)NC(=S)N1CCOCC1)C(=O)NC(=S)N1CCOCC1 |
| InChI | InChI=1S/C17H28N4O4S2/c1-3-17(4-2,13(22)18-15(26)20-5-9-24-10-6-20)14(23)19-16(27)21-7-11-25-12-8-21/h3-12H2,1-2H3,(H,18,22,26)(H,19,23,27) |
| InChIKey | LRVNSYLMKPJKBK-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|