C11H20N2O4S — CID 99975528
N-[(3S,4R)-4-morpholin-4-yl-1,1-dioxothiolan-3-yl]propanamide (PubChem CID 99975528) has the molecular formula C11H20N2O4S and a molecular weight of 276.36 g/mol. Its IUPAC name is N-[(3S,4R)-4-morpholin-4-yl-1,1-dioxothiolan-3-yl]propanamide.
| Compound Name | N-[(3S,4R)-4-morpholin-4-yl-1,1-dioxothiolan-3-yl]propanamide |
|---|---|
| PubChem CID | 99975528 |
| Molecular Formula | C11H20N2O4S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | N-[(3S,4R)-4-morpholin-4-yl-1,1-dioxothiolan-3-yl]propanamide |
| SMILES | CCC(=O)N[C@@H]1CS(=O)(=O)C[C@@H]1N1CCOCC1 |
| InChI | InChI=1S/C11H20N2O4S/c1-2-11(14)12-9-7-18(15,16)8-10(9)13-3-5-17-6-4-13/h9-10H,2-8H2,1H3,(H,12,14)/t9-,10+/m1/s1 |
| InChIKey | JNGCRSFIQPFOEQ-ZJUUUORDSA-N |
| XLogP | -0.99 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |