C25H46O5Si2 — CID 123161647
[2-methoxy-4-[3-[2-[2-methoxypropan-2-yl(dimethyl)silyl]oxypropan-2-yl-dimethylsilyl]propyl]phenyl] butanoate (PubChem CID 123161647) has the molecular formula C25H46O5Si2 and a molecular weight of 482.81 g/mol. Its IUPAC name is [2-methoxy-4-[3-[2-[2-methoxypropan-2-yl(dimethyl)silyl]oxypropan-2-yl-dimethylsilyl]propyl]phenyl] butanoate.
| Compound Name | [2-methoxy-4-[3-[2-[2-methoxypropan-2-yl(dimethyl)silyl]oxypropan-2-yl-dimethylsilyl]propyl]phenyl] butanoate |
|---|---|
| PubChem CID | 123161647 |
| Molecular Formula | C25H46O5Si2 |
| Molecular Weight | 482.81 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | [2-methoxy-4-[3-[2-[2-methoxypropan-2-yl(dimethyl)silyl]oxypropan-2-yl-dimethylsilyl]propyl]phenyl] butanoate |
| SMILES | CCCC(=O)Oc1ccc(CCC[Si](C)(C)C(C)(C)O[Si](C)(C)C(C)(C)OC)cc1OC |
| InChI | InChI=1S/C25H46O5Si2/c1-12-14-23(26)29-21-17-16-20(19-22(21)27-6)15-13-18-31(8,9)25(4,5)30-32(10,11)24(2,3)28-7/h16-17,19H,12-15,18H2,1-11H3 |
| InChIKey | INXBWWJUDYGCQP-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.81 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|