C15H19NO3S2 — CID 59487804
(2-carbamoylphenyl) 5-(dithiolan-3-yl)pentanoate (PubChem CID 59487804) has the molecular formula C15H19NO3S2 and a molecular weight of 325.45 g/mol. Its IUPAC name is (2-carbamoylphenyl) 5-(dithiolan-3-yl)pentanoate.
| Compound Name | (2-carbamoylphenyl) 5-(dithiolan-3-yl)pentanoate |
|---|---|
| PubChem CID | 59487804 |
| Molecular Formula | C15H19NO3S2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | (2-carbamoylphenyl) 5-(dithiolan-3-yl)pentanoate |
| SMILES | NC(=O)c1ccccc1OC(=O)CCCCC1CCSS1 |
| InChI | InChI=1S/C15H19NO3S2/c16-15(18)12-6-2-3-7-13(12)19-14(17)8-4-1-5-11-9-10-20-21-11/h2-3,6-7,11H,1,4-5,8-10H2,(H2,16,18) |
| InChIKey | ZJEISLTVGCSUJL-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|