C13H16O3S2 — CID 25132801
(4-hydroxyphenyl) 4-(dithiolan-3-yl)butanoate (PubChem CID 25132801) has the molecular formula C13H16O3S2 and a molecular weight of 284.40 g/mol. Its IUPAC name is (4-hydroxyphenyl) 4-(dithiolan-3-yl)butanoate.
| Compound Name | (4-hydroxyphenyl) 4-(dithiolan-3-yl)butanoate |
|---|---|
| PubChem CID | 25132801 |
| Molecular Formula | C13H16O3S2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | (4-hydroxyphenyl) 4-(dithiolan-3-yl)butanoate |
| SMILES | O=C(CCCC1CCSS1)Oc1ccc(O)cc1 |
| InChI | InChI=1S/C13H16O3S2/c14-10-4-6-11(7-5-10)16-13(15)3-1-2-12-8-9-17-18-12/h4-7,12,14H,1-3,8-9H2 |
| InChIKey | LXMSMEMJUJNTIY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|