C19H31NO5S3 — CID 158465655
benzenesulfonate;2-[5-[(3R)-dithiolan-3-yl]pentanoyloxy]ethyl-trimethylazanium (PubChem CID 158465655) has the molecular formula C19H31NO5S3 and a molecular weight of 449.66 g/mol. Its IUPAC name is benzenesulfonate;2-[5-[(3R)-dithiolan-3-yl]pentanoyloxy]ethyl-trimethylazanium.
| Compound Name | benzenesulfonate;2-[5-[(3R)-dithiolan-3-yl]pentanoyloxy]ethyl-trimethylazanium |
|---|---|
| PubChem CID | 158465655 |
| Molecular Formula | C19H31NO5S3 |
| Molecular Weight | 449.66 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | benzenesulfonate;2-[5-[(3R)-dithiolan-3-yl]pentanoyloxy]ethyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCOC(=O)CCCC[C@@H]1CCSS1.O=S(=O)([O-])c1ccccc1 |
| InChI | InChI=1S/C13H26NO2S2.C6H6O3S/c1-14(2,3)9-10-16-13(15)7-5-4-6-12-8-11-17-18-12;7-10(8,9)6-4-2-1-3-5-6/h12H,4-11H2,1-3H3;1-5H,(H,7,8,9)/q+1;/p-1/t12-;/m1./s1 |
| InChIKey | HFSIKZZTWMTDPM-UTONKHPSSA-M |
| XLogP | 3.54 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.66 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|