C25H39NO7S2 — CID 76789745
1-[(2,4-dimethoxyphenyl)methyl-(4-hydroxy-3-methylbutan-2-yl)carbamoyl]oxyethyl 5-(dithiolan-3-yl)pentanoate (PubChem CID 76789745) has the molecular formula C25H39NO7S2 and a molecular weight of 529.72 g/mol. Its IUPAC name is 1-[(2,4-dimethoxyphenyl)methyl-(4-hydroxy-3-methylbutan-2-yl)carbamoyl]oxyethyl 5-(dithiolan-3-yl)pentanoate.
| Compound Name | 1-[(2,4-dimethoxyphenyl)methyl-(4-hydroxy-3-methylbutan-2-yl)carbamoyl]oxyethyl 5-(dithiolan-3-yl)pentanoate |
|---|---|
| PubChem CID | 76789745 |
| Molecular Formula | C25H39NO7S2 |
| Molecular Weight | 529.72 g/mol |
| Exact Mass | 529.22 |
| IUPAC Name | 1-[(2,4-dimethoxyphenyl)methyl-(4-hydroxy-3-methylbutan-2-yl)carbamoyl]oxyethyl 5-(dithiolan-3-yl)pentanoate |
| SMILES | COc1ccc(CN(C(=O)OC(C)OC(=O)CCCCC2CCSS2)C(C)C(C)CO)c(OC)c1 |
| InChI | InChI=1S/C25H39NO7S2/c1-17(16-27)18(2)26(15-20-10-11-21(30-4)14-23(20)31-5)25(29)33-19(3)32-24(28)9-7-6-8-22-12-13-34-35-22/h10-11,14,17-19,22,27H,6-9,12-13,15-16H2,1-5H3 |
| InChIKey | OJOBCNLDHGXAKL-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.72 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|