C19H27NO5S2 — CID 7963151
methyl 5-[(2R)-2-[5-[(3S)-dithiolan-3-yl]pentanoyloxy]propanoyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate (PubChem CID 7963151) has the molecular formula C19H27NO5S2 and a molecular weight of 413.56 g/mol. Its IUPAC name is methyl 5-[(2R)-2-[5-[(3S)-dithiolan-3-yl]pentanoyloxy]propanoyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate.
| Compound Name | methyl 5-[(2R)-2-[5-[(3S)-dithiolan-3-yl]pentanoyloxy]propanoyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 7963151 |
| Molecular Formula | C19H27NO5S2 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | methyl 5-[(2R)-2-[5-[(3S)-dithiolan-3-yl]pentanoyloxy]propanoyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
| SMILES | COC(=O)c1c(C)[nH]c(C(=O)[C@@H](C)OC(=O)CCCC[C@H]2CCSS2)c1C |
| InChI | InChI=1S/C19H27NO5S2/c1-11-16(19(23)24-4)12(2)20-17(11)18(22)13(3)25-15(21)8-6-5-7-14-9-10-26-27-14/h13-14,20H,5-10H2,1-4H3/t13-,14+/m1/s1 |
| InChIKey | MDPJJQYUXNQXQU-KGLIPLIRSA-N |
| XLogP | 4.25 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|