C16H25NO5S3 — CID 129028519
1-[(2,2-dimethyl-4-oxothietan-3-yl)carbamoyloxy]ethyl 5-[(3R)-dithiolan-3-yl]pentanoate (PubChem CID 129028519) has the molecular formula C16H25NO5S3 and a molecular weight of 407.58 g/mol. Its IUPAC name is 1-[(2,2-dimethyl-4-oxothietan-3-yl)carbamoyloxy]ethyl 5-[(3R)-dithiolan-3-yl]pentanoate.
| Compound Name | 1-[(2,2-dimethyl-4-oxothietan-3-yl)carbamoyloxy]ethyl 5-[(3R)-dithiolan-3-yl]pentanoate |
|---|---|
| PubChem CID | 129028519 |
| Molecular Formula | C16H25NO5S3 |
| Molecular Weight | 407.58 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 1-[(2,2-dimethyl-4-oxothietan-3-yl)carbamoyloxy]ethyl 5-[(3R)-dithiolan-3-yl]pentanoate |
| SMILES | CC(OC(=O)CCCC[C@@H]1CCSS1)OC(=O)NC1C(=O)SC1(C)C |
| InChI | InChI=1S/C16H25NO5S3/c1-10(22-15(20)17-13-14(19)24-16(13,2)3)21-12(18)7-5-4-6-11-8-9-23-25-11/h10-11,13H,4-9H2,1-3H3,(H,17,20)/t10?,11-,13?/m1/s1 |
| InChIKey | DAHPXBAXFWGSLO-QWKFWESOSA-N |
| XLogP | 3.74 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.58 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|