C19H26N2O4S2 — CID 8883480
[(2S)-1-(benzylcarbamoylamino)-1-oxopropan-2-yl] 5-[(3S)-dithiolan-3-yl]pentanoate (PubChem CID 8883480) has the molecular formula C19H26N2O4S2 and a molecular weight of 410.56 g/mol. Its IUPAC name is [(2S)-1-(benzylcarbamoylamino)-1-oxopropan-2-yl] 5-[(3S)-dithiolan-3-yl]pentanoate.
| Compound Name | [(2S)-1-(benzylcarbamoylamino)-1-oxopropan-2-yl] 5-[(3S)-dithiolan-3-yl]pentanoate |
|---|---|
| PubChem CID | 8883480 |
| Molecular Formula | C19H26N2O4S2 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | [(2S)-1-(benzylcarbamoylamino)-1-oxopropan-2-yl] 5-[(3S)-dithiolan-3-yl]pentanoate |
| SMILES | C[C@H](OC(=O)CCCC[C@H]1CCSS1)C(=O)NC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C19H26N2O4S2/c1-14(25-17(22)10-6-5-9-16-11-12-26-27-16)18(23)21-19(24)20-13-15-7-3-2-4-8-15/h2-4,7-8,14,16H,5-6,9-13H2,1H3,(H2,20,21,23,24)/t14-,16-/m0/s1 |
| InChIKey | JOUNNGFVBYZRHO-HOCLYGCPSA-N |
| XLogP | 3.66 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|