C23H35NO6S2 — CID 118303384
[3-[1-[5-(dithiolan-3-yl)pentanoyloxy]ethoxycarbonylamino]-2-methylbutyl] cyclohexa-1,5-diene-1-carboxylate (PubChem CID 118303384) has the molecular formula C23H35NO6S2 and a molecular weight of 485.67 g/mol. Its IUPAC name is [3-[1-[5-(dithiolan-3-yl)pentanoyloxy]ethoxycarbonylamino]-2-methylbutyl] cyclohexa-1,5-diene-1-carboxylate.
| Compound Name | [3-[1-[5-(dithiolan-3-yl)pentanoyloxy]ethoxycarbonylamino]-2-methylbutyl] cyclohexa-1,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 118303384 |
| Molecular Formula | C23H35NO6S2 |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | [3-[1-[5-(dithiolan-3-yl)pentanoyloxy]ethoxycarbonylamino]-2-methylbutyl] cyclohexa-1,5-diene-1-carboxylate |
| SMILES | CC(OC(=O)CCCCC1CCSS1)OC(=O)NC(C)C(C)COC(=O)C1=CCCC=C1 |
| InChI | InChI=1S/C23H35NO6S2/c1-16(15-28-22(26)19-9-5-4-6-10-19)17(2)24-23(27)30-18(3)29-21(25)12-8-7-11-20-13-14-31-32-20/h5,9-10,16-18,20H,4,6-8,11-15H2,1-3H3,(H,24,27) |
| InChIKey | DJGZQAKJVVZZMI-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|