C19H29NO3 — CID 112790503
3-cyclohexyl-N-[(2,4-dimethoxyphenyl)methyl]-N-methylpropanamide (PubChem CID 112790503) has the molecular formula C19H29NO3 and a molecular weight of 319.44 g/mol. Its IUPAC name is 3-cyclohexyl-N-[(2,4-dimethoxyphenyl)methyl]-N-methylpropanamide.
| Compound Name | 3-cyclohexyl-N-[(2,4-dimethoxyphenyl)methyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 112790503 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.44 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | 3-cyclohexyl-N-[(2,4-dimethoxyphenyl)methyl]-N-methylpropanamide |
| SMILES | COc1ccc(CN(C)C(=O)CCC2CCCCC2)c(OC)c1 |
| InChI | InChI=1S/C19H29NO3/c1-20(19(21)12-9-15-7-5-4-6-8-15)14-16-10-11-17(22-2)13-18(16)23-3/h10-11,13,15H,4-9,12,14H2,1-3H3 |
| InChIKey | GJIZHUJISXYPPW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.44 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |