C34H42N2O9S2 — CID 89181254
[4-[(1E,6E)-7-(4-hydroxy-3-methoxyphenyl)-3,5-dioxohepta-1,6-dienyl]-2-methoxyphenyl] N-[2-[2-[5-[(3R)-dithiolan-3-yl]pentanoylamino]ethoxy]ethyl]carbamate (PubChem CID 89181254) has the molecular formula C34H42N2O9S2 and a molecular weight of 686.85 g/mol. Its IUPAC name is [4-[(1E,6E)-7-(4-hydroxy-3-methoxyphenyl)-3,5-dioxohepta-1,6-dienyl]-2-methoxyphenyl] N-[2-[2-[5-[(3R)-dithiolan-3-yl]pentanoylamino]ethoxy]ethyl]carbamate.
| Compound Name | [4-[(1E,6E)-7-(4-hydroxy-3-methoxyphenyl)-3,5-dioxohepta-1,6-dienyl]-2-methoxyphenyl] N-[2-[2-[5-[(3R)-dithiolan-3-yl]pentanoylamino]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 89181254 |
| Molecular Formula | C34H42N2O9S2 |
| Molecular Weight | 686.85 g/mol |
| Exact Mass | 686.23 |
| IUPAC Name | [4-[(1E,6E)-7-(4-hydroxy-3-methoxyphenyl)-3,5-dioxohepta-1,6-dienyl]-2-methoxyphenyl] N-[2-[2-[5-[(3R)-dithiolan-3-yl]pentanoylamino]ethoxy]ethyl]carbamate |
| SMILES | COc1cc(/C=C/C(=O)CC(=O)/C=C/c2ccc(OC(=O)NCCOCCNC(=O)CCCC[C@@H]3CCSS3)c(OC)c2)ccc1O |
| InChI | InChI=1S/C34H42N2O9S2/c1-42-31-21-24(9-13-29(31)39)7-11-26(37)23-27(38)12-8-25-10-14-30(32(22-25)43-2)45-34(41)36-17-19-44-18-16-35-33(40)6-4-3-5-28-15-20-46-47-28/h7-14,21-22,28,39H,3-6,15-20,23H2,1-2H3,(H,35,40)(H,36,41)/b11-7+,12-8+/t28-/m1/s1 |
| InChIKey | NVGLNJXJLUZEDG-DMBGDEDLSA-N |
| XLogP | 5.60 |
| TPSA | 149.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.85 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|