C17H20FN2OS+ — CID 9446766
N-(3-fluoro-4-methylphenyl)-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]acetamide (PubChem CID 9446766) has the molecular formula C17H20FN2OS+ and a molecular weight of 319.43 g/mol. Its IUPAC name is N-(3-fluoro-4-methylphenyl)-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]acetamide.
| Compound Name | N-(3-fluoro-4-methylphenyl)-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 9446766 |
| Molecular Formula | C17H20FN2OS+ |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | N-(3-fluoro-4-methylphenyl)-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]acetamide |
| SMILES | Cc1ccc(NC(=O)C[NH+]2CCC[C@@H]2c2cccs2)cc1F |
| InChI | InChI=1S/C17H19FN2OS/c1-12-6-7-13(10-14(12)18)19-17(21)11-20-8-2-4-15(20)16-5-3-9-22-16/h3,5-7,9-10,15H,2,4,8,11H2,1H3,(H,19,21)/p+1/t15-/m1/s1 |
| InChIKey | GESZJTWZVYODER-OAHLLOKOSA-O |
| XLogP | 2.55 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |