C18H21N2O2S+ — CID 9446358
N-(3-acetylphenyl)-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]acetamide (PubChem CID 9446358) has the molecular formula C18H21N2O2S+ and a molecular weight of 329.45 g/mol. Its IUPAC name is N-(3-acetylphenyl)-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]acetamide.
| Compound Name | N-(3-acetylphenyl)-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 9446358 |
| Molecular Formula | C18H21N2O2S+ |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | N-(3-acetylphenyl)-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]acetamide |
| SMILES | CC(=O)c1cccc(NC(=O)C[NH+]2CCC[C@@H]2c2cccs2)c1 |
| InChI | InChI=1S/C18H20N2O2S/c1-13(21)14-5-2-6-15(11-14)19-18(22)12-20-9-3-7-16(20)17-8-4-10-23-17/h2,4-6,8,10-11,16H,3,7,9,12H2,1H3,(H,19,22)/p+1/t16-/m1/s1 |
| InChIKey | JDKHPOKVIIREBL-MRXNPFEDSA-O |
| XLogP | 2.31 |
| TPSA | 50.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |