C22H32N4OS+2 — CID 9299861
N-[4-(4-ethylpiperazin-4-ium-1-yl)phenyl]-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]acetamide (PubChem CID 9299861) has the molecular formula C22H32N4OS+2 and a molecular weight of 400.59 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-4-ium-1-yl)phenyl]-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]acetamide.
| Compound Name | N-[4-(4-ethylpiperazin-4-ium-1-yl)phenyl]-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 9299861 |
| Molecular Formula | C22H32N4OS+2 |
| Molecular Weight | 400.59 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | N-[4-(4-ethylpiperazin-4-ium-1-yl)phenyl]-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]acetamide |
| SMILES | CC[NH+]1CCN(c2ccc(NC(=O)C[NH+]3CCC[C@@H]3c3cccs3)cc2)CC1 |
| InChI | InChI=1S/C22H30N4OS/c1-2-24-12-14-25(15-13-24)19-9-7-18(8-10-19)23-22(27)17-26-11-3-5-20(26)21-6-4-16-28-21/h4,6-10,16,20H,2-3,5,11-15,17H2,1H3,(H,23,27)/p+2/t20-/m1/s1 |
| InChIKey | KGIDAMYGLXBYLK-HXUWFJFHSA-P |
| XLogP | 0.83 |
| TPSA | 41.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.59 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|