C18H22BrN2OS+ — CID 11944178
N-[(1S)-1-(4-bromophenyl)ethyl]-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]acetamide (PubChem CID 11944178) has the molecular formula C18H22BrN2OS+ and a molecular weight of 394.36 g/mol. Its IUPAC name is N-[(1S)-1-(4-bromophenyl)ethyl]-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]acetamide.
| Compound Name | N-[(1S)-1-(4-bromophenyl)ethyl]-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 11944178 |
| Molecular Formula | C18H22BrN2OS+ |
| Molecular Weight | 394.36 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | N-[(1S)-1-(4-bromophenyl)ethyl]-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]acetamide |
| SMILES | C[C@H](NC(=O)C[NH+]1CCC[C@@H]1c1cccs1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H21BrN2OS/c1-13(14-6-8-15(19)9-7-14)20-18(22)12-21-10-2-4-16(21)17-5-3-11-23-17/h3,5-9,11,13,16H,2,4,10,12H2,1H3,(H,20,22)/p+1/t13-,16+/m0/s1 |
| InChIKey | VIXPHDGRZVQASP-XJKSGUPXSA-O |
| XLogP | 3.11 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |