C20H29N2OS+ — CID 9446384
N-(1-adamantyl)-2-[(2S)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]acetamide (PubChem CID 9446384) has the molecular formula C20H29N2OS+ and a molecular weight of 345.53 g/mol. Its IUPAC name is N-(1-adamantyl)-2-[(2S)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]acetamide.
| Compound Name | N-(1-adamantyl)-2-[(2S)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 9446384 |
| Molecular Formula | C20H29N2OS+ |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | N-(1-adamantyl)-2-[(2S)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]acetamide |
| SMILES | O=C(C[NH+]1CCC[C@H]1c1cccs1)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H28N2OS/c23-19(13-22-5-1-3-17(22)18-4-2-6-24-18)21-20-10-14-7-15(11-20)9-16(8-14)12-20/h2,4,6,14-17H,1,3,5,7-13H2,(H,21,23)/p+1/t14?,15?,16?,17-,20?/m0/s1 |
| InChIKey | VCNVZARTXMHKMO-FAKMSMKASA-O |
| XLogP | 2.55 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |