C17H21N2OS2+ — CID 9446614
N-(2-methylsulfanylphenyl)-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]acetamide (PubChem CID 9446614) has the molecular formula C17H21N2OS2+ and a molecular weight of 333.50 g/mol. Its IUPAC name is N-(2-methylsulfanylphenyl)-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]acetamide.
| Compound Name | N-(2-methylsulfanylphenyl)-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 9446614 |
| Molecular Formula | C17H21N2OS2+ |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | N-(2-methylsulfanylphenyl)-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]acetamide |
| SMILES | CSc1ccccc1NC(=O)C[NH+]1CCC[C@@H]1c1cccs1 |
| InChI | InChI=1S/C17H20N2OS2/c1-21-15-8-3-2-6-13(15)18-17(20)12-19-10-4-7-14(19)16-9-5-11-22-16/h2-3,5-6,8-9,11,14H,4,7,10,12H2,1H3,(H,18,20)/p+1/t14-/m1/s1 |
| InChIKey | PXUYXISESHQLFV-CQSZACIVSA-O |
| XLogP | 2.83 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |