C17H18F3N2OS+ — CID 9446648
2-[(2S)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 9446648) has the molecular formula C17H18F3N2OS+ and a molecular weight of 355.41 g/mol. Its IUPAC name is 2-[(2S)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[(2S)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 9446648 |
| Molecular Formula | C17H18F3N2OS+ |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 2-[(2S)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(C[NH+]1CCC[C@H]1c1cccs1)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C17H17F3N2OS/c18-17(19,20)12-5-1-2-6-13(12)21-16(23)11-22-9-3-7-14(22)15-8-4-10-24-15/h1-2,4-6,8,10,14H,3,7,9,11H2,(H,21,23)/p+1/t14-/m0/s1 |
| InChIKey | GRNOSFCUQVRSGC-AWEZNQCLSA-O |
| XLogP | 3.13 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |